Norfloxacino
Nome IUPAC (sistemática) | |
1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-1H-quinoline-3-carboxylic acid | |
Identificadores | |
CAS | 70458-96-7 |
ATC | J01RA13 J01MA06 AE02(({2))} |
PubChem | 4539 |
DrugBank | DB01059 |
ChemSpider | |
Informação química | |
Fórmula molecular | C16H18N3FO3 |
Massa molar | 319.336 |
SMILES | O=C(O)\C2=C\N(c1cc(c(F)cc1C2=O)N3CCNCC3)CC |
Dados físicos | |
Ponto de fusão | 220 a 221 °C |
Farmacocinética | |
Biodisponibilidade | 30 to 40% |
Ligação a proteínas | 10 to 15% |
Metabolismo | Hepático |
Meia-vida | 3 a 4 horas |
Excreção | Renal e fecal |
Considerações terapêuticas | |
Administração | ? |
DL50 | ? |
Norfloxacino é um antibiótico da classe das fluoroquinolonas de segunda geração que é usado para infecções do trato urinário.[1] Mais sobre este antibiótico você encontrará em Quinolona.
Referências
[editar | editar código-fonte]- ↑ P.R.Vade-mécum ABIMIP 2006/2007
Text is available under the CC BY-SA 4.0 license; additional terms may apply.
Images, videos and audio are available under their respective licenses.